EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27882 - (S)-colchicine
| Formula | C22H25NO6 |
| Net Charge | 0 |
| Average Mass | 399.443 |
| Monoisotopic Mass | 399.16819 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | IAKHMKGGTNLKSZ-INIZCTEOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-colchicine (CHEBI:27882) has role anti-inflammatory agent (CHEBI:67079) |
| (S)-colchicine (CHEBI:27882) has role gout suppressant (CHEBI:35845) |
| (S)-colchicine (CHEBI:27882) has role mutagen (CHEBI:25435) |
| (S)-colchicine (CHEBI:27882) is a alkaloid (CHEBI:22315) |
| (S)-colchicine (CHEBI:27882) is a colchicine (CHEBI:23359) |
| (S)-colchicine (CHEBI:27882) is enantiomer of (R)-colchicine (CHEBI:51074) |
| Incoming Relation(s) |
| (R)-colchicine (CHEBI:51074) is enantiomer of (S)-colchicine (CHEBI:27882) |
| IUPAC Name |
|---|
| N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]acetamide |
| Synonyms | Source |
|---|---|
| Colchicine | KEGG COMPOUND |
| 7αH-colchicine | NIST Chemistry WebBook |
| (S)-N-(5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl)acetamide | NIST Chemistry WebBook |
| colchicina | DrugBank |
| colchicinum | DrugBank |
| Colchicin | ChemIDplus |
| Brand Names | Source |
|---|---|
| Colchisol | ChemIDplus |
| Colcin | ChemIDplus |
| Kolkicin | ChemIDplus |
| Goutnil | ChemIDplus |
| Condylon | ChemIDplus |
| Mitigare | ChemIDplus |
| Citations |
|---|