EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(CO)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h20-25,31-32H,1,8-18H2,2-7H3/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1 |
| InChIKey | FVWJYYTZTCVBKE-ROUWMTJPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral agent A substance that destroys or inhibits replication of viruses. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betulin (CHEBI:3086) has parent hydride lupane (CHEBI:36485) |
| betulin (CHEBI:3086) has role analgesic (CHEBI:35480) |
| betulin (CHEBI:3086) has role anti-inflammatory agent (CHEBI:67079) |
| betulin (CHEBI:3086) has role antineoplastic agent (CHEBI:35610) |
| betulin (CHEBI:3086) has role antiviral agent (CHEBI:22587) |
| betulin (CHEBI:3086) has role metabolite (CHEBI:25212) |
| betulin (CHEBI:3086) is a diol (CHEBI:23824) |
| betulin (CHEBI:3086) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| betulin di(3-carboxybutanoate) (CHEBI:65486) has functional parent betulin (CHEBI:3086) |
| IUPAC Name |
|---|
| (3β)-lup-20(29)-ene-3,28-diol |
| Synonyms | Source |
|---|---|
| Betulol | ChemIDplus |
| Betuline | ChemIDplus |
| Betulinol | ChemIDplus |
| Trochol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08618 | KEGG COMPOUND |
| Betulin | Wikipedia |
| HMDB0036838 | HMDB |
| C00003740 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2064515 | Reaxys |
| CAS:473-98-3 | KEGG COMPOUND |
| CAS:473-98-3 | ChemIDplus |
| Citations |
|---|