GO:1900772
JSON
fumitremorgin B biosynthetic process
Biological Process
Definition (GO:1900772 GONUTS page)
The chemical reactions and pathways resulting in the formation of the indole alkaloid fumitremorgin B. PMID:18683158
Secondary IDs
GO:1900770
Synonyms
Synonyms are alternative words or phrases closely related in meaning to the term name, with indication of the relationship between the name and synonym given by the synonym scope.
Synonym | Type |
---|---|
fumitremorgin B biosynthesis | exact |
fumitremorgin B anabolism | exact |
Lanosulin formation | related |
fumitremorgin B metabolic process | broad |
Lanosulin metabolic process | related |
Lanosulin metabolism | related |
fumitremorgin B metabolism | exact |
fumitremorgin B synthesis | exact |
Lanosulin synthesis | related |
Lanosulin anabolism | related |
Ancestor Chart
Annotation Blacklist
This list aims to correct incorrect annotations to UniProtKB accessions inferred from electronic annotation (IEA) methods that are supplied by the UniProt-GOA project to the GO Consortium:
Category | Entity Type | Entity ID | Taxon ID | Entity Name | Ancestor GO ID | Reason | Rule/Method ID |
---|---|---|---|---|---|---|---|
NOT-qualified manual | protein | A0A6A4NPZ7 | 3870 | ITHAT_LUPAL | GO:0009821 | 2 NOT-qualified manual annotations exist with these evidence codes: ECO:0000314, ECO:0000315 from this reference: PMID:37540741 |
Cross-Ontology Relations
Relation | Other Ontology | ID | Term |
---|---|---|---|
has_primary_output | CHEBI | CHEBI:64531 | fumitremorgin B |
Replaces
This term can be used instead of these obsolete terms:
GO Identifier | GO Term Name | Reason |
---|---|---|
GO:0140653 | obsolete fumitremorgin C biosynthetic process | replaced_by GO:1900772 |
Co-occurring Terms
These tables show the number of times the term listed in the table has been co-annotated.
No co-occurrence statistics for GO:1900772 based on ALL annotations
The top 19 of 19 co-occurring terms
Co-occurring Term | PR | S% | #Together | #Compared |
---|---|---|---|---|
fumitremorgin B biosynthetic process
|
64,979,596.00 | 100.00 | 3 | 3 |
brevianamide F biosynthetic process
|
64,979,596.00 | 33.33 | 1 | 1 |
verruculogen biosynthetic process
|
12,183,674.00 | 18.75 | 3 | 16 |
nonribosomal peptide biosynthetic process
|
2,406,651.80 | 3.45 | 1 | 27 |
alkaloid metabolic process
|
6,543.77 | 0.01 | 1 | 9,930 |
cellular_component
|
2,071.43 | 0.00 | 2 | 62,739 |
secondary metabolic process
|
728.66 | 0.00 | 1 | 89,177 |
O-methyltransferase activity
|
590.88 | 0.00 | 1 | 109,971 |
secondary metabolite biosynthetic process
|
534.17 | 0.00 | 2 | 243,292 |
amino acid activation for nonribosomal peptide biosynthetic process
|
516.63 | 0.00 | 1 | 125,775 |
Totals | 25 | 44817043 |
No co-occurrence statistics for GO:1900772 based on MANUAL annotations
The top 12 of 12 co-occurring terms
Co-occurring Term | PR | S% | #Together | #Compared |
---|---|---|---|---|
fumitremorgin B biosynthetic process
|
430,599.70 | 100.00 | 3 | 3 |
brevianamide F biosynthetic process
|
430,599.66 | 33.33 | 1 | 1 |
verruculogen biosynthetic process
|
80,737.44 | 18.75 | 3 | 16 |
nonribosomal peptide biosynthetic process
|
18,721.73 | 4.00 | 1 | 23 |
phosphopantetheine binding
|
4,680.43 | 1.06 | 1 | 92 |
amino acid activation for nonribosomal peptide biosynthetic process
|
2,851.65 | 0.65 | 1 | 151 |
secondary metabolite biosynthetic process
|
1,202.79 | 0.28 | 1 | 358 |
prenyltransferase activity
|
721.27 | 0.17 | 1 | 597 |
secondary metabolic process
|
492.11 | 0.11 | 1 | 875 |
O-methyltransferase activity
|
275.14 | 0.06 | 1 | 1,565 |
Totals | 17 | 245809 |
Change Log
- All changes
- All changes
- Term
- Term
- Definition / Synonyms
- Definition / Synonyms
- Relationships
- Relationships
- Cross-references
- Cross-references
- Other
- Other
Timestamp | Action | Category | Detail |
---|---|---|---|
2022-07-02 | Added | SYNONYM | fumitremorgin B metabolism |
2022-07-02 | Added | SYNONYM | Lanosulin metabolic process |
2022-07-02 | Added | SYNONYM | fumitremorgin B metabolic process |
2022-07-02 | Added | SECONDARY | GO:1900770 (fumitremorgin B metabolic process) |
2022-07-02 | Deleted | RELATION | is a GO:0044550 (secondary metabolite biosynthetic process) |
2022-07-02 | Deleted | RELATION | is a GO:1900770 (fumitremorgin B metabolic process) |
2022-07-02 | Deleted | DEFINITION | The chemical reactions and pathways resulting in the formation of fumitremorgin B. |
2022-07-02 | Added | DEFINITION | The chemical reactions and pathways resulting in the formation of the indole alkaloid fumitremorgin B. |
2022-07-02 | Added | SYNONYM | Lanosulin metabolism |
2020-06-02 | Added | RELATION | is a GO:0044550 (secondary metabolite biosynthetic process) |
Timestamp | Action | Category | Detail |
---|---|---|---|
2012-06-07 | Added | TERM | fumitremorgin B biosynthetic process |
Timestamp | Action | Category | Detail |
---|---|---|---|
2022-07-02 | Added | SYNONYM | fumitremorgin B metabolism |
2022-07-02 | Added | SYNONYM | Lanosulin metabolic process |
2022-07-02 | Added | SYNONYM | fumitremorgin B metabolic process |
2022-07-02 | Deleted | DEFINITION | The chemical reactions and pathways resulting in the formation of fumitremorgin B. |
2022-07-02 | Added | DEFINITION | The chemical reactions and pathways resulting in the formation of the indole alkaloid fumitremorgin B. |
2022-07-02 | Added | SYNONYM | Lanosulin metabolism |
2012-06-12 | Deleted | SYNONYM | C27H33N3O5 anabolism |
2012-06-12 | Deleted | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione synthesis |
2012-06-12 | Deleted | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 biosynthetic process |
2012-06-12 | Deleted | SYNONYM | C27H33N3O5 biosynthetic process |
2012-06-12 | Deleted | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N biosynthesis |
2012-06-12 | Deleted | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N synthesis |
2012-06-12 | Deleted | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 anabolism |
2012-06-12 | Deleted | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N formation |
2012-06-12 | Deleted | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 synthesis |
2012-06-12 | Deleted | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione formation |
2012-06-12 | Deleted | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 biosynthesis |
2012-06-12 | Deleted | SYNONYM | C27H33N3O5 synthesis |
2012-06-12 | Deleted | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O biosynthesis |
2012-06-12 | Deleted | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione anabolism |
2012-06-12 | Deleted | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O biosynthetic process |
2012-06-12 | Deleted | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione biosynthetic process |
2012-06-12 | Deleted | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O anabolism |
2012-06-12 | Deleted | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N anabolism |
2012-06-12 | Deleted | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N biosynthetic process |
2012-06-12 | Deleted | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 formation |
2012-06-12 | Deleted | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione biosynthesis |
2012-06-12 | Deleted | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O formation |
2012-06-12 | Deleted | SYNONYM | C27H33N3O5 biosynthesis |
2012-06-12 | Deleted | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O synthesis |
2012-06-12 | Deleted | SYNONYM | C27H33N3O5 formation |
2012-06-07 | Added | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O anabolism |
2012-06-07 | Added | SYNONYM | C27H33N3O5 biosynthetic process |
2012-06-07 | Added | SYNONYM | C27H33N3O5 synthesis |
2012-06-07 | Added | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O biosynthetic process |
2012-06-07 | Added | DEFINITION | The chemical reactions and pathways resulting in the formation of fumitremorgin B. |
2012-06-07 | Added | SYNONYM | C27H33N3O5 biosynthesis |
2012-06-07 | Added | SYNONYM | C27H33N3O5 formation |
2012-06-07 | Added | SYNONYM | Lanosulin anabolism |
2012-06-07 | Added | SYNONYM | Lanosulin synthesis |
2012-06-07 | Added | SYNONYM | fumitremorgin B synthesis |
2012-06-07 | Added | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione anabolism |
2012-06-07 | Added | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione biosynthesis |
2012-06-07 | Added | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 anabolism |
2012-06-07 | Added | SYNONYM | Lanosulin formation |
2012-06-07 | Added | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O synthesis |
2012-06-07 | Added | SYNONYM | fumitremorgin B anabolism |
2012-06-07 | Added | SYNONYM | fumitremorgin B biosynthesis |
2012-06-07 | Added | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 biosynthetic process |
2012-06-07 | Added | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 formation |
2012-06-07 | Added | SYNONYM | Lanosulin biosynthesis |
2012-06-07 | Added | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O biosynthesis |
2012-06-07 | Added | SYNONYM | C27H33N3O5 anabolism |
2012-06-07 | Added | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 synthesis |
2012-06-07 | Added | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N biosynthesis |
2012-06-07 | Added | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N formation |
2012-06-07 | Added | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N synthesis |
2012-06-07 | Added | SYNONYM | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O formation |
2012-06-07 | Added | SYNONYM | fumitremorgin B formation |
2012-06-07 | Added | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione synthesis |
2012-06-07 | Added | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione biosynthetic process |
2012-06-07 | Added | SYNONYM | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 biosynthesis |
2012-06-07 | Added | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N anabolism |
2012-06-07 | Added | SYNONYM | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N biosynthetic process |
2012-06-07 | Added | SYNONYM | (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione formation |
2012-06-07 | Added | SYNONYM | Lanosulin biosynthetic process |
Timestamp | Action | Category | Detail |
---|---|---|---|
2022-07-02 | Deleted | RELATION | is a GO:0044550 (secondary metabolite biosynthetic process) |
2022-07-02 | Deleted | RELATION | is a GO:1900770 (fumitremorgin B metabolic process) |
2020-06-02 | Added | RELATION | is a GO:0044550 (secondary metabolite biosynthetic process) |
2020-06-02 | Deleted | RELATION | is a GO:0043386 (mycotoxin biosynthetic process) |
2017-11-29 | Deleted | RELATION | is a GO:0044550 (secondary metabolite biosynthetic process) |
2017-11-29 | Added | RELATION | is a GO:0043386 (mycotoxin biosynthetic process) |
2012-10-19 | Added | RELATION | is a GO:0044550 (secondary metabolite biosynthetic process) |
2012-09-30 | Added | RELATION | is a GO:1901378 (organic heteropentacyclic compound biosynthetic process) |
2012-09-30 | Deleted | RELATION | is a GO:1901362 (obsolete organic cyclic compound biosynthetic process) |
2012-09-30 | Deleted | RELATION | is a GO:0018130 (obsolete heterocycle biosynthetic process) |
2012-09-19 | Added | RELATION | is a GO:1901362 (obsolete organic cyclic compound biosynthetic process) |
2012-06-07 | Added | RELATION | is a GO:0018130 (obsolete heterocycle biosynthetic process) |
2012-06-07 | Added | RELATION | is a GO:1900770 (fumitremorgin B metabolic process) |
2012-06-07 | Added | RELATION | is a GO:0035835 (indole alkaloid biosynthetic process) |
Timestamp | Action | Category | Detail |
---|
Timestamp | Action | Category | Detail |
---|---|---|---|
2022-07-02 | Added | SECONDARY | GO:1900770 (fumitremorgin B metabolic process) |
Not found :(
Sorry, but the Term you were trying to view does not exist.
Reported error:
It looks like this may have been caused by:
- a mistyped URL
- an out-of-date link