EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO |
| Net Charge | 0 |
| Average Mass | 109.128 |
| Monoisotopic Mass | 109.05276 |
| SMILES | [H][C@]12CC=CN1C(=O)C2 |
| InChI | InChI=1S/C6H7NO/c8-6-4-5-2-1-3-7(5)6/h1,3,5H,2,4H2/t5-/m1/s1 |
| InChIKey | YZBQHRLRFGPBSL-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbapenem (CHEBI:46765) is a carbapenems (CHEBI:46633) |
| Incoming Relation(s) |
| 1β-methylcarbapenem (CHEBI:46764) has functional parent carbapenem (CHEBI:46765) |
| IUPAC Name |
|---|
| 2,3-didehydro-1-carbapenam |
| Synonym | Source |
|---|---|
| (5R)-1-azabicyclo[3.2.0]hept-2-en-7-one | IUPAC |