InChI=1S/C22H32O5/c1- 21- 8- 7- 13(23) 9- 12(21) 3- 4- 14- 15- 5- 6- 16(17(24) 10- 19(26) 27) 22(15,2) 11- 18(25) 20(14) 21/h9,14- 18,20,24- 25H,3- 8,10- 11H2,1- 2H3,(H,26,27) /t14- ,15- ,16+,17?,18- ,20+,21- ,22- /m0/s1 |
MSUMOHDXPKCNSB-CUOJZFFHSA-N |
O[C@@H]1[C@]2([C@]([C@]3([C@@]([C@H](CC3)C(O)CC(O)=O)(C1)C)[H])(CCC=4[C@@]2(CCC(=O)C4)C)[H])[H] |
|
androgen
A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors.
|
|
3- hydroxy- 3- [(8S,9S,10R,11S,13S,14S,17S)- 11- hydroxy- 10,13- dimethyl- 3- oxo- 1,2,6,7,8,9,11,12,14,15,16,17- dodecahydrocyclopenta[a]phenanthren- 17- yl]propanoic acid
|