EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N4 |
| Net Charge | 0 |
| Average Mass | 492.711 |
| Monoisotopic Mass | 492.32530 |
| SMILES | c1ccc2c(NCCCCCCCNc3c4c(nc5ccccc35)CCCC4)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C33H40N4/c1(2-12-22-34-32-24-14-4-8-18-28(24)36-29-19-9-5-15-25(29)32)3-13-23-35-33-26-16-6-10-20-30(26)37-31-21-11-7-17-27(31)33/h4,6,8,10,14,16,18,20H,1-3,5,7,9,11-13,15,17,19,21-23H2,(H,34,36)(H,35,37) |
| InChIKey | ITZOKHKOFJOBFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(7)-tacrine (CHEBI:138435) has functional parent tacrine (CHEBI:45980) |
| bis(7)-tacrine (CHEBI:138435) has role apoptosis inhibitor (CHEBI:68494) |
| bis(7)-tacrine (CHEBI:138435) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| bis(7)-tacrine (CHEBI:138435) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| bis(7)-tacrine (CHEBI:138435) has role neuroprotective agent (CHEBI:63726) |
| bis(7)-tacrine (CHEBI:138435) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N,N'-di(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine |
| Synonyms | Source |
|---|---|
| N,N'-bis(1,2,3,4-tetrahydro-9-acridinyl)-1,7-heptanediamine | SUBMITTER |
| heptylene-bis(tacrine) | ChEBI |
| B7T | ChEBI |
| bis(7)-tetrahydroaminacrine | ChEBI |
| Citations |
|---|