EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.C7H7O7 |
| Net Charge | -1 |
| Average Mass | 205.142 |
| Monoisotopic Mass | 205.03538 |
| SMILES | O=C([O-])CCC(C(=O)[O-])C(O)C(=O)[O-].[H+].[H+] |
| InChI | InChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/p-1 |
| InChIKey | OEJZZCGRGVFWHK-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoisocitrate(1−) (CHEBI:36456) is a tricarboxylic acid monoanion (CHEBI:36299) |
| homoisocitrate(1−) (CHEBI:36456) is conjugate acid of homoisocitrate(2−) (CHEBI:36455) |
| homoisocitrate(1−) (CHEBI:36456) is conjugate base of homoisocitric acid (CHEBI:29094) |
| Incoming Relation(s) |
| homoisocitric acid (CHEBI:29094) is conjugate acid of homoisocitrate(1−) (CHEBI:36456) |
| homoisocitrate(2−) (CHEBI:36455) is conjugate base of homoisocitrate(1−) (CHEBI:36456) |
| IUPAC Name |
|---|
| dihydrogen 1-hydroxybutane-1,2,4-tricarboxylate |
| Synonym | Source |
|---|---|
| dihydrogen homoisocitrate | ChEBI |