EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35N3O4 |
| Net Charge | 0 |
| Average Mass | 453.583 |
| Monoisotopic Mass | 453.26276 |
| SMILES | CCc1c(Cc2nc(Cc3nc(C(=O)O)c(C)c3CC)c(CC)c2CC)nc(C(=O)O)c1C |
| InChI | InChI=1S/C26H35N3O4/c1-7-15-13(5)23(25(30)31)28-19(15)11-21-17(9-3)18(10-4)22(27-21)12-20-16(8-2)14(6)24(29-20)26(32)33/h27-29H,7-12H2,1-6H3,(H,30,31)(H,32,33) |
| InChIKey | AUDZWJHKEGBIFV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-bis(5-carboxy-3-ethyl-4-methylpyrrol-2-ylmethyl)-3,4-diethylpyrrole (CHEBI:59935) is a dicarboxylic acid (CHEBI:35692) |
| 2,5-bis(5-carboxy-3-ethyl-4-methylpyrrol-2-ylmethyl)-3,4-diethylpyrrole (CHEBI:59935) is a tripyrrane (CHEBI:59934) |
| IUPAC Name |
|---|
| 5,5'-[(3,4-diethyl-1H-pyrrole-2,5-diyl)dimethanediyl]bis(4-ethyl-3-methyl-1H-pyrrole-2-carboxylic acid) |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3576605 | Beilstein |
| Citations |
|---|