Marvin 06290712012D 12 9 0 0 0 0 999 V2000 -1.0717 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3572 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3572 -0.2062 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.0717 1.0312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3572 -1.0312 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 -1.4437 0.0000 Au 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 -1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7862 -0.2062 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 2.5007 0.2063 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0 -1.7862 0.2062 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 -2.5007 -0.2063 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0 8 1 2 0 0 0 0 1 2 1 0 0 0 0 5 3 2 0 0 0 0 2 4 1 0 0 0 0 4 3 1 0 0 0 0 6 4 1 0 0 0 0 9 3 1 0 0 0 0 11 1 1 0 0 0 0 6 7 1 0 0 0 0 M CHG 4 9 -1 10 1 11 -1 12 1 M END > CHEBI:35864 > disodium aurothiomalate > An organic sodium salt which is the disodium salt of gold thiomalic acid, with a basic unit comprising two sodium cations and a divalent aurothiomalate anion. > 3 > sodium aurum(I) thiomalate; sodium aurothiomalate; Na2[Au(thiomalate)]; gold sodium thiomalate; disodium thiomalato-S-gold(I); disodium thiomalato-S-aurate(I); [(1,2-dicarboxyethyl)thio]gold disodium salt > disodium [2-(sulfanyl-kappaS)butanedioato(3-)]aurate(2-) > C4H3AuNa2O4S > 390.07631 > 389.92131 > 0 > [Na+].[Na+].[O-]C(=O)CC(S[Au])C([O-])=O > InChI=1S/C4H6O4S.Au.2Na/c5-3(6)1-2(9)4(7)8;;;/h2,9H,1H2,(H,5,6)(H,7,8);;;/q;3*+1/p-3 > VXIHRIQNJCRFQX-UHFFFAOYSA-K > 1308855 > 14647662 $$$$