Marvin 05171211402D 15 15 0 0 0 0 999 V2000 21.3163 -9.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.6018 -9.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.6018 -10.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3163 -11.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.0307 -10.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.0307 -9.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3163 -8.6254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.0307 -8.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3163 -11.9254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.0307 -12.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.7452 -9.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.4597 -9.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.1741 -9.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.4597 -10.6879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 19.8873 -11.1004 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 2 0 0 0 0 3 4 1 0 0 0 0 4 5 2 0 0 0 0 5 6 1 0 0 0 0 1 6 2 0 0 0 0 1 7 1 0 0 0 0 7 8 1 0 0 0 0 4 9 1 0 0 0 0 9 10 1 0 0 0 0 6 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 14 1 0 0 0 0 3 15 1 0 0 0 0 M END > CHEBI:64629 > 2-(4-iodo-2,5-dimethoxyphenyl)-1-methylethylamine > An organoiodine compound that is amphetamine bearing two methoxy substituents at positions 2 and 5 as well as an iodo substituent at position 4. > 3 > 4-Iodo-2,5-dimethoxyphenylisopropylamine; 4-DOI; 2,5-Dimethoxy-4-iodophenylisopropylamine; 2,5-Dimethoxy-4-iodoamphetamine; 1-(4-Iodo-2,5-dimethoxyphenyl)-2-aminopropane; 1-(2,5-Dimethoxy-4-iodophenyl)-2-aminopropane > 1-(4-iodo-2,5-dimethoxyphenyl)propan-2-amine > C11H16INO2 > 321.15470 > 321.02257 > 0 > COc1cc(CC(C)N)c(OC)cc1I > InChI=1S/C11H16INO2/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2/h5-7H,4,13H2,1-3H3 > BGMZUEKZENQUJY-UHFFFAOYSA-N > 64584-34-5 > 2727017 > 64584-34-5 $$$$