Mrv0541 03311511002D 14 13 0 0 0 0 999 V2000 7.4446 -9.0946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.1591 -9.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8736 -9.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5881 -9.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3025 -9.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0170 -9.5071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.7315 -9.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4459 -9.5071 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 13.1604 -9.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8749 -9.5071 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 8.1591 -10.3321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3025 -8.2696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4459 -10.3321 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 13.1604 -8.2696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 2 11 2 0 0 0 0 5 12 2 0 0 0 0 8 13 1 1 0 0 0 9 14 2 0 0 0 0 M CHG 2 10 -1 13 1 M END > CHEBI:84331 > N(3)-fumaramoyl-(S)-2,3-diaminopropanoic acid zwitterion > An L-α-amino acid zwitterion that results from the transfer of a proton from the carboxylic acid group to the α-amino group of N3-fumaramoyl-(S)-2,3-diaminopropanoic acid; major species at pH 7.3. > 3 > N(3)-fumaramoyl-(S)-2,3-diaminopropanoate; (2E)-4-[[(2S)-2-amino-2-carboxyethyl]amino]-4-oxobut-2-enoate > (2S)-3-{[(2E)-4-amino-4-oxobut-2-enoyl]amino}-2-azaniumylpropanoate > C7H11N3O4 > 201.17990 > 201.07496 > 0 > NC(=O)\C=C\C(=O)NC[C@H]([NH3+])C([O-])=O > InChI=1S/C7H11N3O4/c8-4(7(13)14)3-10-6(12)2-1-5(9)11/h1-2,4H,3,8H2,(H2,9,11)(H,10,12)(H,13,14)/b2-1+/t4-/m0/s1 > TXNRYTCUNXUNFH-QPHDTYRISA-N > CPD-17544 > 19807062 $$$$