Ketcher 05132017232D 1 1.00000 0.00000 0 19 20 0 0 0 999 V2000 35.7248 -83.7537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 34.8550 -82.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 35.7248 -82.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.8550 -84.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.9853 -82.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.9853 -83.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.1155 -84.2485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 33.1155 -82.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 34.8550 -85.2532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 36.5945 -82.2541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 32.2458 -83.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 32.2458 -82.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.3841 -82.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.1155 -81.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.9822 -79.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.1155 -79.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 32.2490 -79.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 32.2490 -80.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.8488 -79.2671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 1 4 1 0 0 0 2 3 1 0 0 0 2 5 2 0 0 0 3 10 2 0 0 0 4 6 1 0 0 0 4 9 2 0 0 0 5 6 1 0 0 0 5 8 1 0 0 0 6 7 2 0 0 0 7 11 1 0 0 0 8 12 1 0 0 0 11 12 2 0 0 0 12 13 1 0 0 0 8 14 1 0 0 0 15 16 1 0 0 0 16 17 1 0 0 0 14 18 1 0 0 0 17 18 1 0 0 0 15 19 1 0 0 0 M END > CHEBI:149729 > 8-(5-hydroxypentyl)-7-methyllumazine > A pteridine that is lumazine substituted with a 5-hydroxypentyl group at position 8 and a methyl group at position 7; one of 20 modifications to the potent microbial riboflavin-based metabolite antigen 5-(2-oxopropylideneamino)-6-D-ribityl aminouracil (5-OP-RU), an activator of mucosal-associated invariant T (MAIT) cells when presented by the MR1 protein (reported in MED:32123373). > 3 > 8-(5-hydroxypentyl)-7-methyl-2,4(3H,8H)-pteridinedione; 5'-OH-pentyl-L-7-Me > 8-(5-hydroxypentyl)-7-methylpteridine-2,4(3H,8H)-dione > C12H16N4O3 > 264.285 > 264.12224 > 0 > N1C(N=C2C(C1=O)=NC=C(N2CCCCCO)C)=O > InChI=1S/C12H16N4O3/c1-8-7-13-9-10(14-12(19)15-11(9)18)16(8)5-3-2-4-6-17/h7,17H,2-6H2,1H3,(H,15,18,19) > UYKIUTVUACYUBQ-UHFFFAOYSA-N > 32123373 $$$$