Marvin 05261115132D 12 12 0 0 0 0 999 V2000 6.3379 -2.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6234 -2.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9090 -2.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1945 -2.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4800 -2.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0523 -2.5853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4800 -1.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1945 -0.9352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9090 -1.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6234 -3.4102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7655 -2.5853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7655 -0.9352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 4 5 1 0 0 0 0 1 6 1 0 0 0 0 7 5 2 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 9 3 1 0 0 0 0 2 10 1 0 0 0 0 5 11 1 0 0 0 0 7 12 1 0 0 0 0 M END > CHEBI:1387 > 3,4-dihydroxyphenylethyleneglycol > A tetrol composed of ethyleneglycol having a 3,4-dihydroxyphenyl group at the 1-position. > 3 > DOPEG; Dihydroxyphenylethylene glycol; DHPG; beta,3,4-trihydroxy phenethyl alcohol; 3,4-Dihydroxyphenylglycol; 3,4-dihydroxyphenylethyleneglycol; 3,4-dihydroxyphenylethyl glycol; 3,4-dihydroxyphenethyl glycol; 2-hydroxy-2-(3,4-dihydroxy)phenylethanol; 1-(3,4-dihydroxyphenyl)-1,2-ethanediol; (3,4-dihydroxyphenyl)ethylene glycol > 4-(1,2-dihydroxyethyl)benzene-1,2-diol > C8H10O4 > 170.16260 > 170.05791 > 0 > OCC(O)c1ccc(O)c(O)c1 > InChI=1S/C8H10O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8-12H,4H2 > MTVWFVDWRVYDOR-UHFFFAOYSA-N > 3343-19-9 > 2210995 > 3343-19-9 > C05576 > CPD-11878 > 11479664; 16218695; 16819902; 22770225; 2468969; 2645784; 2907005; 3161030; 4091997; 6146669; 6497782; 6671452; 6875564; 7176821 $$$$