Ketcher 07081511342D 1 1.00000 0.00000 0 24 24 0 0 0 999 V2000 9.4060 -17.0471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4060 -18.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2718 -18.5467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.1375 -18.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1375 -17.0471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2718 -16.5473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.2718 -15.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2718 -19.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1375 -15.0478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.0033 -15.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4060 -15.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1375 -20.0463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.4060 -20.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5403 -15.5476 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 9.4060 -14.0481 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 12.0033 -16.5473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5403 -19.5463 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 9.4060 -21.0459 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 12.0033 -19.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0033 -18.5467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8691 -15.0478 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8691 -20.0463 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5395 -14.5376 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 8.5395 -20.5477 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 7 11 1 0 0 0 5 6 1 0 0 0 8 12 1 0 0 0 6 1 1 0 0 0 8 13 1 0 0 0 11 14 1 0 0 0 6 7 1 0 0 0 1 2 1 0 0 0 11 15 1 0 0 0 3 8 1 0 0 0 10 16 2 0 0 0 2 3 1 0 0 0 7 9 1 0 0 0 13 17 1 0 0 0 3 4 1 0 0 0 13 18 1 0 0 0 9 10 1 0 0 0 12 19 1 0 0 0 4 5 1 0 0 0 19 20 2 0 0 0 10 21 1 0 0 0 19 22 1 0 0 0 11 23 1 0 0 0 13 24 1 0 0 0 M END > CHEBI:9715 > triforine > A member of the class of N-alkylpiperazines in which the two amino groups of piperazine are replaced by 1-formamido-2,2,2-trichloroethyl groups. A fungicide active against a range of diseases including powdery mildew, scab and rust. > 3 > N,N'-(Piperazine-1,4-diylbis((trichloromethyl)methylene))diformamide; N,N'-(1,4-Piperazinediylbis(2,2,2-trichloroethylidene))bisformamide; Biformylchlorazin; 1,4-Bis(2,2,2-trichloro-1-formamidoethyl)piperazine; 1,4-Bis(1-formamido-2,2,2-trichloroethyl)piperazine > N,N'-[piperazine-1,4-diylbis(2,2,2-trichloroethane-1,1-diyl)]diformamide > Funginex; Funginex > C10H14Cl6N4O2 > 434.96200 > 431.92479 > 0 > ClC(Cl)(Cl)C(NC=O)N1CCN(CC1)C(NC=O)C(Cl)(Cl)Cl > InChI=1S/C10H14Cl6N4O2/c11-9(12,13)7(17-5-21)19-1-2-20(4-3-19)8(18-6-22)10(14,15)16/h5-8H,1-4H2,(H,17,21)(H,18,22) > RROQIUMZODEXOR-UHFFFAOYSA-N > 26644-46-2 > 626358 > 26644-46-2 > C10960 > triforine > 1002932; 1267484; 15052559; 24122157; 2471555; 597629; 680740; 7821004; 890154 $$$$