Ketcher 09172009402D 1 1.00000 0.00000 0 25 26 0 0 0 999 V2000 6.5166 -9.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5166 -10.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6505 -8.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6505 -10.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7846 -9.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7846 -10.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6505 -11.9156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3826 -10.9157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2487 -10.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6505 -7.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5165 -7.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5165 -6.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6505 -5.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3825 -5.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6505 -4.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3825 -4.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5165 -4.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7844 -6.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7845 -4.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9185 -4.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2486 -4.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1146 -4.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9807 -4.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8467 -4.9156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9807 -3.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 1 3 2 0 0 0 2 4 2 0 0 0 3 5 1 0 0 0 4 6 1 0 0 0 5 6 2 0 0 0 4 7 1 0 0 0 2 8 1 0 0 0 8 9 1 0 0 0 3 10 1 0 0 0 10 11 2 0 0 0 11 12 1 0 0 0 12 13 1 0 0 0 12 14 2 0 0 0 13 15 2 0 0 0 14 16 1 0 0 0 15 17 1 0 0 0 16 17 2 0 0 0 13 18 1 0 0 0 15 19 1 0 0 0 19 20 1 0 0 0 16 21 1 0 0 0 21 22 2 0 0 0 22 23 1 0 0 0 23 24 1 0 0 0 23 25 2 0 0 0 M END > CHEBI:156511 > poacic acid > A hydroxycinnamic acid that is (2E)-3-phenylprop-2-enoic acid in which the hydrogens at positions 3, 4 and 5 are replaced by 2-(4-hydroxy-3-methoxyphenyl)ethenyl, hydroxy and methoxy groups, respectively. It is a natural product found in maize bran which exhibits antifungal activities against several fungal and oomycete pathogens including Sclerotinia sclerotiorum, Alternaria solani, and Phytophthora sojae. It inhibits β-1,3-glucan synthesis in cells walls resulting in rapid cell lysis. > 3 > decarboxylated 8,5'-diferulic acid; 8,5'-diferulic acid (decarboxylated form); 3-(3-methoxy-4-hydroxystyryl)-4-hydroxy-5-methoxycinnamic acid > (2E)-3-{4-hydroxy-3-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-5-methoxyphenyl}prop-2-enoic acid > C19H18O6 > 342.347 > 342.11034 > 0 > COC1=C(O)C=CC(\C=C\C2=CC(\C=C\C(O)=O)=CC(OC)=C2O)=C1 > InChI=1S/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ > SLIMCXCSQXYCGL-JENUQAQBSA-N > Decarboxylated_8,5'-diferulic_acid > IND605665043; IND606777426 > 15495409; 25775513; 28787158; 30370375 $$$$