Marvin 04041217352D 19 19 0 0 0 0 999 V2000 11.0501 -11.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7646 -11.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0501 -12.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4791 -11.1283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.0501 -13.6033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.3357 -11.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6212 -11.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9067 -11.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4777 -13.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7633 -12.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7633 -11.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4777 -11.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1922 -11.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1922 -12.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0488 -13.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6212 -12.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3343 -12.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0488 -14.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3377 -13.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 1 1 0 0 0 0 6 1 2 0 0 0 0 4 2 3 0 0 0 0 5 3 3 0 0 0 0 7 6 1 0 0 0 0 8 7 2 0 0 0 0 16 7 1 0 0 0 0 13 8 1 0 0 0 0 14 9 2 0 0 0 0 10 9 1 0 0 0 0 11 10 2 0 0 0 0 15 10 1 0 0 0 0 12 11 1 0 0 0 0 13 12 2 0 0 0 0 14 13 1 0 0 0 0 15 17 1 0 0 0 0 15 18 1 0 0 0 0 15 19 1 0 0 0 0 M END > CHEBI:64343 > trans-2-[3-(4-tert-butylphenyl)-2-methyl-2-propenylidene]malononitrile > A dinitrile that is tert-butylbenzene in which the hydrogen at the para- position is substituted by a 4,4-dicyano-2-methylbuta-1,3-dien-1-yl group (the trans isomer). It is used as a matrix in matrix-assisted laser desorption/ionization (MALDI) mass spectrometry. > 3 > trans-2-[3-(4-t-butylphenyl)-2-methyl-2-propenylidene]malononitrile; DCTB; (2E)-2-[3-(4-tert-butylphenyl)-2-methylprop-2-en-1-ylidene]malononitrile > [(2E)-3-(4-tert-butylphenyl)-2-methylprop-2-en-1-ylidene]propanedinitrile > C17H18N2 > 250.33820 > 250.14700 > 0 > C\C(C=C(C#N)C#N)=C/c1ccc(cc1)C(C)(C)C > InChI=1S/C17H18N2/c1-13(10-15(11-18)12-19)9-14-5-7-16(8-6-14)17(2,3)4/h5-10H,1-4H3/b13-9+ > OIASAVWSBWJWBR-UKTHLTGXSA-N > 8913051 $$$$