Marvin 04031314452D 13 12 0 0 0 0 999 V2000 8.1467 -5.2807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8612 -5.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5757 -5.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2901 -5.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0045 -5.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7191 -5.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4335 -5.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1480 -5.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8624 -5.2807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8612 -6.5182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0045 -4.4557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4335 -4.4557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1480 -6.5182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 2 10 2 0 0 0 0 5 11 1 0 0 0 0 7 12 2 0 0 0 0 8 13 2 0 0 0 0 M END > CHEBI:73089 > 4-hydroxy-2-oxoheptanedioic acid > An oxo dicarboxylic acid consisting of pimelic acid substituted at positions 2 and 4 by oxo and hydroxy groups respectively. > 3 > 4-Hydroxy-2-oxoheptanedioic acid; 4-hydroxy-2-ketopimelic acid; 4-Hydroxy-2-ketopimelate; 4-hydroxy-2-ketoheptanedioic acid; 4-hydroxy-2-ketoheptane-1,7-dioic acid; 2-oxo-4-hydroxyhepta-1,7-dioic acid; 2-keto-4-hydroxypimelic acid > 4-hydroxy-2-oxoheptanedioic acid > C7H10O6 > 190.15070 > 190.04774 > 0 > OC(CCC(O)=O)CC(=O)C(O)=O > InChI=1S/C7H10O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h4,8H,1-3H2,(H,10,11)(H,12,13) > HNOAJOYERZTSNK-UHFFFAOYSA-N > C05601 > CPD-804 > 17881002 $$$$