Marvin 12041213342D 15 15 0 0 0 0 999 V2000 10.2486 -28.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8814 -28.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4362 -29.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5785 -30.4179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6633 -29.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2455 -24.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4902 -25.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.1649 -25.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4146 -26.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0915 -26.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3316 -27.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0046 -27.2424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.9047 -29.9955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8968 -28.5364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0284 -27.5166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7 8 1 0 0 0 0 3 4 1 0 0 0 0 8 9 1 0 0 0 0 4 5 1 0 0 0 0 9 10 1 0 0 0 0 5 1 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 1 1 0 0 0 0 1 2 1 0 0 0 0 5 13 2 0 0 0 0 6 7 1 0 0 0 0 11 14 2 0 0 0 0 2 3 1 0 0 0 0 9 15 2 0 0 0 0 M END > CHEBI:29640 > N-(3-oxohexanoyl)homoserine lactone > A N-acyl homoserine lactone that is the monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 3-oxohexanoic acid with the amino group of homoserine lactone. > 3 > N-(beta-ketocapryloyl)-homoserine lactone; N-(3-oxohexanoyl)homoserine lactone; N-(3-Oxohexanoyl)homoserine lactone; N-(3-oxohexanoyl)-3-aminodihydro-2(3H)-furanone; Luciferase autoinducer; Autoinducer 1; AI-1 lactone; AI-1 (Vibrio fischeri); 3-oxo-N-(tetrahydro-2-oxo-3-furanyl)hexanamide; 3-oxo-C6-AHL > 3-oxo-N-(2-oxotetrahydrofuran-3-yl)hexanamide > C10H15NO4 > 213.23040 > 213.10011 > 0 > CCCC(=O)CC(=O)NC1CCOC1=O > InChI=1S/C10H15NO4/c1-2-3-7(12)6-9(13)11-8-4-5-15-10(8)14/h8H,2-6H2,1H3,(H,11,13) > YRYOXRMDHALAFL-UHFFFAOYSA-N > 76924-95-3 > 13576940 > 76924-95-3 > C11839 > CPD-10780 > 7236614 $$$$