Ketcher 09031913032D 1 1.00000 0.00000 0 11 10 0 1 0 999 V2000 9.8629 -11.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7288 -12.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5949 -11.5790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.4610 -12.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3269 -11.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7288 -13.0790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9968 -12.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8629 -10.5790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.1308 -11.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3269 -10.5790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.1930 -12.0790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 7 1 0 0 0 1 8 1 6 0 0 2 1 1 0 0 0 2 6 2 0 0 0 2 3 1 0 0 0 3 4 1 0 0 0 4 5 1 0 0 0 5 10 2 0 0 0 5 11 1 0 0 0 7 9 1 0 0 0 M END > CHEBI:144728 > N-[(2S)-2-aminobutanoyl]glycine > A dipeptide resulting from the formal condensation of the carboxy group of L-α-aminobutyric acid [(2S)-2-aminobutanoic acid] with the amino group of glycine. > 3 > {[(2S)-2-aminobutanoyl]amino}acetic acid; H-Abu-Gly-OH; 2-[(2S)-2-aminobutanamido]acetic acid > N-[(2S)-2-aminobutanoyl]glycine; N-(L-alpha-aminobutanoyl)glycine > C6H12N2O3 > 160.173 > 160.08479 > 0 > [C@@H](CC)(N)C(=O)NCC(=O)O > InChI=1S/C6H12N2O3/c1-2-4(7)6(11)8-3-5(9)10/h4H,2-3,7H2,1H3,(H,8,11)(H,9,10)/t4-/m0/s1 > SVHUWZOIWWJJJM-BYPYZUCNSA-N > 30692244 $$$$