Ketcher 05142009402D 1 1.00000 0.00000 0 22 22 0 1 0 999 V2000 10.7672 -89.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6284 -90.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6351 -91.3695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.5026 -91.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5026 -92.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3631 -91.3800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.3698 -93.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6354 -93.3733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.2303 -91.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2370 -92.8704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.3698 -94.3737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0976 -91.3786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6363 -94.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7690 -94.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7698 -95.8784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9010 -94.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6284 -88.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7609 -88.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4961 -88.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3637 -88.3756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9012 -90.3861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8918 -88.3783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 3 1 0 0 0 3 4 1 0 0 0 4 5 2 0 0 0 4 6 1 0 0 0 5 7 1 0 0 0 5 8 1 0 0 0 6 9 1 0 0 0 7 10 1 0 0 0 7 11 2 0 0 0 9 12 2 0 0 0 9 10 1 0 0 0 8 13 2 0 0 0 13 14 1 0 0 0 14 15 2 0 0 0 14 16 1 0 0 0 17 18 1 0 0 0 2 1 1 0 0 0 18 1 1 0 0 0 17 19 1 0 0 0 19 20 1 0 0 0 1 21 1 6 0 0 18 22 1 6 0 0 M END > CHEBI:149744 > 6-[(1,4-dideoxy-D-ribityl)amino]-5-[(E)-(2-oxopropylidene)amino]uracil > A nucleobase analogue that is uracil substituted with a (1,4-dideoxy-D-ribityl)amino group at position 6 and an (E)-(2-oxopropylidene)amino group at position 5; one of 20 modifications to the potent microbial riboflavin-based metabolite antigen 5-(2-oxopropylideneamino)-6-D-ribityl aminouracil (5-OP-RU), an activator of mucosal-associated invariant T (MAIT) cells when presented by the MR1 protein (reported in MED:32123373). > 3 > 6-[(1,4-dideoxy-D-ribityl)amino]-5-[(E)-(2-oxopropylidene)amino]uracil; 4'-D-5-OP-RU; 1,4-dideoxy-1-[[1,2,3,6-tetrahydro-2,6-dioxo-5-[[(1E)-2-oxopropylidene]amino]-4-pyrimidinyl]amino]-D-erythro-pentitol > 1,4-dideoxy-1-({2,6-dioxo-5-[(E)-(2-oxopropylidene)amino]-1,2,3,6-tetrahydropyrimidin-4-yl}amino)-D-erythro-pentitol > C12H18N4O6 > 314.298 > 314.12263 > 0 > [C@H](CNC1=C(C(NC(N1)=O)=O)/N=C/C(=O)C)([C@@H](CCO)O)O > InChI=1S/C12H18N4O6/c1-6(18)4-13-9-10(15-12(22)16-11(9)21)14-5-8(20)7(19)2-3-17/h4,7-8,17,19-20H,2-3,5H2,1H3,(H3,14,15,16,21,22)/b13-4+/t7-,8+/m1/s1 > LFFDRPXUQKVYPE-ZGBHKRMMSA-N > 32123373 $$$$