Ketcher 05142016192D 1 1.00000 0.00000 0 16 17 0 0 0 999 V2000 29.8381 -168.4342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 28.9684 -166.9493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 29.8381 -167.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.9684 -168.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.0986 -167.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.0986 -168.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.2287 -168.9290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 27.2287 -166.9493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 28.9684 -169.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 30.7081 -166.9343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.3589 -168.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.3589 -167.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.2287 -165.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 26.3620 -165.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.4954 -165.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 25.4971 -166.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 1 4 1 0 0 0 2 3 1 0 0 0 2 5 2 0 0 0 3 10 2 0 0 0 4 6 1 0 0 0 4 9 2 0 0 0 5 6 1 0 0 0 5 8 1 0 0 0 6 7 2 0 0 0 7 11 1 0 0 0 8 12 1 0 0 0 11 12 2 0 0 0 8 13 1 0 0 0 13 14 1 0 0 0 14 15 1 0 0 0 12 16 1 0 0 0 M END > CHEBI:149755 > 7-(2-hydroxyethyl)-6-methyllumazine > A pteridine that is lumazine substituted with a 2-hydroxyethyl group at position 8 and a methyl group at position 7; one of 20 modifications to the potent microbial riboflavin-based metabolite antigen 5-(2-oxopropylideneamino)-6-D-ribityl aminouracil (5-OP-RU), an activator of mucosal-associated invariant T (MAIT) cells when presented by the MR1 protein (reported in MED:32123373). > 3 > 8-(2-hydroxyethyl)-7-methyl-2,4(3H,8H)-pteridinedione; 2'-OH-butyl-L-6-Me > 8-(2-hydroxyethyl)-7-methylpteridine-2,4(3H,8H)-dione > C9H10N4O3 > 222.204 > 222.07529 > 0 > N1C(N=C2C(C1=O)=NC=C(N2CCO)C)=O > InChI=1S/C9H10N4O3/c1-5-4-10-6-7(13(5)2-3-14)11-9(16)12-8(6)15/h4,14H,2-3H2,1H3,(H,12,15,16) > ULCSJOUNPLEEFB-UHFFFAOYSA-N > 32123373 $$$$