InChI=1S/C26H34O7/c1- 13- 22(4) 12- 15- 23(5,26(13,20(31) 33- 8) 19(30) 25(7,32) 18(22) 29) 10- 9- 14- 21(2,3) 16(27) 11- 17(28) 24(14,15) 6/h9,15,17,28,32H,1,10- 12H2,2- 8H3/t15- ,17- ,22- ,23+,24- ,25+,26+/m1/s1 |
BNDPVNXDSQOTOY-OKCDOLPESA-N |
COC(=O)[C@@]12C(=C)[C@@](C)(C[C@@H]3[C@]1(C)CC=C1C(C)(C)C(=O)C[C@@H](O)[C@@]31C)C(=O)[C@](C)(O)C2=O |
|
Penicillium rubrum
(NCBI:txid1266769)
|
Chloroform extract
See:
PubMed
|
cysteine protease inhibitor
Any protease inhibitor that restricts the action of a cysteine protease.
Penicillium metabolite
Any fungal metabolite produced during a metabolic reaction in Penicillium.
metabolite
Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites.
(via meroterpenoid )
|
|
methyl (1R,6aS,7R,9S,11R,12aR,12bS)- 1,9- dihydroxy- 4,4,6a,9,11,12b- hexamethyl- 13- methylidene- 3,8,10- trioxo- 1,3,4,6,6a,8,9,10,11,12,12a,12b- dodecahydro- 7,11- methanocycloocta[a]naphthalene- 7(2H)- carboxylate
|