wortmannin (CHEBI:52289)

ChEBI > Main

CHEBI:52289 - wortmannin

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	wortmannin

ChEBI ID	CHEBI:52289

Stars	This entity has been manually annotated by the ChEBI Team.

Submitter	Sandra Orchard

Secondary ChEBI IDs	CHEBI:43674

Supplier Information	ChemicalBook:CB5855401, ZINC000005854633

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__353229862410555__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__353229862410555__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do;jsessionid=68D298F506217AB52FE470D81D06F3AF?chebiId=CHEBI%3A52289","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__353229862410555__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"353229862410555","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__353229862410555__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

KWT - Ideal conformer

Mrv1927 10282111103D

starting HoverWatcher_5

Time for openFile(KWT - Ideal conformer

Mrv1927 10282111103D

55 59 0 0 0 0 999 V2000

0.9950 -0.2240 1.9290 C 0 0 1 0 0 0 0 0 0 0 0 0

0.7910 -0.5540 3.3300 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.1050 -0.7940 1.0370 C 0 0 1 0 0 0 0 0 0 0 0 0

0.9730 1.3020 1.8270 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.4230 -0.8070 3.8930 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.5450 -1.3680 4.9640 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.5760 -0.3480 3.0920 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.3820 -0.3360 1.6820 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.8380 0.0960 3.2880 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4920 0.1710 1.1140 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4620 0.3590 -0.3410 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.3810 0.3980 2.0830 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.4720 0.6330 -0.9670 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.1370 0.1940 -0.9990 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3270 0.1180 -0.4340 O 0 0 0 0 0 0 0 0 0 0 0 0

1.2440 -0.5500 -1.1350 C 0 0 1 0 0 0 0 0 0 0 0 0

3.5730 -0.3750 -0.4950 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.0590 -0.3340 -0.4020 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.0340 0.6790 -2.4070 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.0490 -2.3250 1.0850 C 0 0 0 0 0 0 0 0 0 0 0 0

1.2770 -0.0600 -2.5820 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.0910 -0.2610 -3.1940 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.5320 -1.7190 -3.0790 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.2740 0.2020 -4.6130 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.3000 0.6410 -3.2650 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.7320 0.6420 -4.7120 C 0 0 2 0 0 0 0 0 0 0 0 0

0.5590 0.2220 -5.4840 O 0 0 0 0 0 0 0 0 0 0 0 0

3.7940 -1.3770 -1.1330 O 0 0 0 0 0 0 0 0 0 0 0 0

4.6960 0.3180 0.2300 C 0 0 0 0 0 0 0 0 0 0 0 0

1.9820 1.8510 2.6760 O 0 0 0 0 0 0 0 0 0 0 0 0

1.9110 3.2720 2.5370 C 0 0 0 0 0 0 0 0 0 0 0 0

1.9560 -0.6040 1.6250 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0030 1.6720 2.1380 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1630 1.6000 0.7960 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.3310 0.1970 4.2440 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4700 -1.6210 -1.1350 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6260 1.6950 -2.4080 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0820 -2.6570 2.1230 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9020 -2.7370 0.5450 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8750 -2.6700 0.6230 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5460 0.9980 -2.6070 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0220 -0.6300 -3.1450 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1880 -2.3570 -3.5910 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.5850 -2.0000 -2.0280 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5130 -1.8380 -3.5380 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8860 -0.2550 -3.0740 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9070 1.5330 -3.0930 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2930 -0.0560 -5.3330 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7920 1.6450 -5.1350 H 0 0 0 0 0 0 0 0 0 0 0 0

5.6260 -0.2240 0.0650 H 0 0 0 0 0 0 0 0 0 0 0 0

4.7980 1.3360 -0.1450 H 0 0 0 0 0 0 0 0 0 0 0 0

4.4760 0.3460 1.2970 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6670 3.7370 3.1700 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0900 3.5440 1.4970 H 0 0 0 0 0 0 0 0 0 0 0 0

0.9220 3.6170 2.8390 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

1 32 1 6 0 0 0

2 5 1 0 0 0 0

3 8 1 0 0 0 0

3 18 1 0 0 0 0

3 20 1 6 0 0 0

4 30 1 0 0 0 0

4 33 1 0 0 0 0

4 34 1 0 0 0 0

5 6 2 0 0 0 0

5 7 1 0 0 0 0

7 8 1 0 0 0 0

7 9 2 0 0 0 0

8 10 2 0 0 0 0

9 12 1 0 0 0 0

9 35 1 0 0 0 0

10 11 1 0 0 0 0

10 12 1 0 0 0 0

11 13 2 0 0 0 0

11 14 1 0 0 0 0

14 18 2 0 0 0 0

14 19 1 0 0 0 0

15 16 1 0 0 0 0

15 17 1 0 0 0 0

16 18 1 0 0 0 0

16 21 1 0 0 0 0

16 36 1 6 0 0 0

17 28 2 0 0 0 0

17 29 1 0 0 0 0

19 22 1 0 0 0 0

19 25 1 0 0 0 0

19 37 1 1 0 0 0

20 38 1 0 0 0 0

20 39 1 0 0 0 0

20 40 1 0 0 0 0

21 22 1 0 0 0 0

21 41 1 0 0 0 0

21 42 1 0 0 0 0

22 23 1 6 0 0 0

22 24 1 0 0 0 0

23 43 1 0 0 0 0

23 44 1 0 0 0 0

23 45 1 0 0 0 0

24 26 1 0 0 0 0

24 27 2 0 0 0 0

25 26 1 0 0 0 0

25 46 1 0 0 0 0

25 47 1 0 0 0 0

26 48 1 0 0 0 0

26 49 1 0 0 0 0

29 50 1 0 0 0 0

29 51 1 0 0 0 0

29 52 1 0 0 0 0

30 31 1 0 0 0 0

31 53 1 0 0 0 0

31 54 1 0 0 0 0

31 55 1 0 0 0 0

M END): 20 ms

reading 55 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

55 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Molfile

Wikipedia	License
Tephrosin is rotenoid. It is a natural fish poison found in the leaves and seeds of Tephrosia purpurea and T. vogelii.
Read full article at Wikipedia

Formula

C23H24O8

Net Charge

Average Mass

428.437

Monoisotopic Mass

428.14712

InChI

InChI=1S/C23H24O8/c1-10(24)30-13-7-22(2)12(5-6-14(22)25)16-18(13)23(3)15(9-28-4)31-21(27)11-8-29-20(17(11)23)19(16)26/h8,12-13,15H,5-7,9H2,1-4H3/t12-,13+,15+,22-,23-/m0/s1

InChIKey

QDLHCMPXEPAAMD-QAIWCSMKSA-N

SMILES

[H][C@@]12CCC(=O)[C@@]1(C)C[C@@H](OC(C)=O)C1=C2C(=O)C2=C3C(=CO2)C(=O)O[C@H](COC)[C@]13C

Roles Classification
Biological Role(s):	EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium.

Application(s):	geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	wortmannin (CHEBI:52289) has role Penicillium metabolite (CHEBI:76964) wortmannin (CHEBI:52289) has role anticoronaviral agent (CHEBI:149553) wortmannin (CHEBI:52289) has role antineoplastic agent (CHEBI:35610) wortmannin (CHEBI:52289) has role autophagy inhibitor (CHEBI:88230) wortmannin (CHEBI:52289) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) wortmannin (CHEBI:52289) has role geroprotector (CHEBI:176497) wortmannin (CHEBI:52289) has role radiosensitizing agent (CHEBI:132992) wortmannin (CHEBI:52289) is a δ-lactone (CHEBI:18946) wortmannin (CHEBI:52289) is a acetate ester (CHEBI:47622) wortmannin (CHEBI:52289) is a cyclic ketone (CHEBI:3992) wortmannin (CHEBI:52289) is a organic heteropentacyclic compound (CHEBI:38164)

Incoming	PX-866 (CHEBI:65345) has functional parent wortmannin (CHEBI:52289)

IUPAC Name

(1S,6bR,9aS,11R,11bR)-9a,11b-dimethyl-1-[(methyloxy)methyl]-3,6,9-trioxo-1,6,6b,7,8,9,9a,10,11,11b-decahydro-3H-furo[4,3,2-de]indeno[4,5-h]isochromen-11-yl acetate

Synonym	Source
Wartmannin	ChemIDplus

Manual Xrefs	Databases
C00023672	KNApSAcK
C15181	KEGG COMPOUND
CPD-11924	MetaCyc
DB08059	DrugBank
HMDB0259902	HMDB
KWT	PDBeChem
LSM-3947	LINCS
Wortmannin	Wikipedia
View more database links

Registry Numbers	Types	Sources
19545-26-7	CAS Registry Number	ChemIDplus
67676	Reaxys Registry Number	Reaxys

Citations

Last Modified

28 October 2021

CHEBI:52289 - wortmannin

ChEBI is part of the ELIXIR infrastructure