InChI=1S/C24H35NO4/c1- 14(2) 11- 20- 22- 17(5) 16(4) 13- 18- 12- 15(3) 7- 6- 8- 19(26) 9- 10- 21(27) 29- 24(18,22) 23(28) 25- 20/h9- 10,12- 14,17- 20,22,26H,6- 8,11H2,1- 5H3,(H,25,28) /b10- 9+,15- 12+/t17- ,18+,19+,20+,22+,24- /m1/s1 |
HXVGXVHKKDWYHZ-CEEOZWHRSA-N |
O=C1O[C@@]23C(=O)N[C@H]([C@@H]2[C@H](C)C(=C[C@@H]3C=C(CCC[C@@H](C=C1)O)C)C)CC(C)C |
|
Aspergillus flavipes
(NCBI:txid41900)
|
See:
PubMed
|
fungal metabolite
Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds.
|
|
View more via ChEBI Ontology
(1R,4E,6S,10E,12S,15S,16S,17S)- 6- hydroxy- 10,14,15- trimethyl- 17- (2- methylpropyl)- 2- oxa- 18- azatricyclo[10.7.0.01,16]nonadeca- 4,10,13- triene- 3,19- dione
|
|