InChI=1S/C24H35NO2/c1- 15(2) 12- 20- 22- 18(5) 17(4) 14- 19- 13- 16(3) 10- 8- 6- 7- 9- 11- 21(26) 24(19,22) 23(27) 25- 20/h9,11,13- 15,18- 20,22H,6- 8,10,12H2,1- 5H3,(H,25,27) /b11- 9- ,16- 13- /t18- ,19+,20+,22+,24- /m1/s1 |
ZRIHKTRPGQFSOY-VXGFLCMSSA-N |
O=C1C=CCCCCC(=C[C@@H]2[C@@]13C(=O)N[C@H]([C@@H]3[C@H](C)C(=C2)C)CC(C)C)C |
|
Aspergillus niveus
(NCBI:txid41281)
|
See:
PubMed
|
fungal metabolite
Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds.
|
|
View more via ChEBI Ontology
(1S,3Z,9Z,11S,14S,15R,16S)- 9,13,14- trimethyl- 16- (2- methylpropyl)- 17- azatricyclo[9.7.0.01,15]octadeca- 3,9,12- triene- 2,18- dione
|
|