InChI=1S/C20H28O4/c1- 19- 8- 7- 12(21) 9- 11(19) 3- 4- 13- 14- 5- 6- 15(18(23) 24) 20(14,2) 10- 16(22) 17(13) 19/h9,13- 17,22H,3- 8,10H2,1- 2H3,(H,23,24) /t13- ,14- ,15+,16+,17+,19- ,20- /m0/s1 |
XEFVQCSDIKHROY-CAPFDLLWSA-N |
O[C@H]1[C@]2([C@]([C@]3([C@](C1)([C@H](CC3)C(O)=O)C)[H])(CCC=4[C@@]2(CCC(=O)C4)C)[H])[H] |
|
Mus musculus
(NCBI:txid10090)
|
Found in
liver
(BTO:0000759).
of strain
C57BL/6J [EFO:0000606]
|
androgen
A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors.
|
|
(8S,9S,10R,11R,13S,14S,17S)- 11- hydroxy- 10,13- dimethyl- 3- oxo- 1,2,6,7,8,9,11,12,14,15,16,17- dodecahydrocyclopenta[a]phenanthrene- 17- carboxylic acid
|