EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N5O |
| Net Charge | 0 |
| Average Mass | 165.156 |
| Monoisotopic Mass | 165.06506 |
| SMILES | COc1nc(N)nc2ncnc12 |
| InChI | InChI=1S/C6H7N5O/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2H,1H3,(H3,7,8,9,10,11) |
| InChIKey | BXJHWYVXLGLDMZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-methylguanine (CHEBI:20689) has role mutagen (CHEBI:25435) |
| 6-O-methylguanine (CHEBI:20689) is a methylguanine (CHEBI:25305) |
| IUPAC Name |
|---|
| 6-methoxy-7H-purin-2-amine |
| Synonyms | Source |
|---|---|
| O-(6)-Methylguanine | ChemIDplus |
| O6-methylguanine | ChemIDplus |
| 6-Methoxyguanine | ChemIDplus |
| 6-Methoxy-1H-purine-2-amine | ChemIDplus |
| 2-Amino-6-methoxypurine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 6-O-Methylguanine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5334996 | Reaxys |
| CAS:20535-83-5 | ChemIDplus |
| Citations |
|---|