InChI=1S/C24H27FN2O2.ClH/c1- 24(2) 20- 5- 3- 4- 6- 21(20) 27(23(24) 29) 16- 15- 26- 13- 11- 18(12- 14- 26) 22(28) 17- 7- 9- 19(25) 10- 8- 17;/h3- 10,18H,11- 16H2,1- 2H3;1H |
BOCLFQZPFYNVFD-UHFFFAOYSA-N |
FC1=CC=C(C(=O)C2CCN(CC2)CCN3C(=O)C(C=4C3=CC=CC4)(C)C)C=C1.Cl |
|
serotonergic antagonist
Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists.
|
|
receptor modulator
A drug that acts as an antagonist, agonist, reverse agonist, or in some other fashion when interacting with cellular receptors.
serotonergic antagonist
Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists.
|
|
View more via ChEBI Ontology
1- [2- (3,3- dimethyl- 2- oxo- 2,3- dihydro- 1H- indol- 1- yl)ethyl]- 4- (4- fluorobenzoyl)piperidinium chloride
|
1- {2- [4- (4- fluorobenzoyl)piperidin- 1- yl]ethyl}- 3,3- dimethyl- 1,3- dihydro- 2H- indol- 2- one hydrochloride
|
1-[2-[4-(4-Fluorobenzoyl)-1-piperidinyl]ethyl]-1,3-dihydro-3,3-dimethyl-2H-indol-2-one hydrochloride
|
SUBMITTER
|
LY-310,762 hydrochloride
|
SUBMITTER
|
LY-310762 HCl
|
ChEBI
|
LY-310762 hydrochloride
|
ChEBI
|
LY310762 HCl
|
ChEBI
|
LY310762 hydrochloride
|
SUBMITTER
|
|