InChI=1S/C29H46O3/c1- 17(2) 18- 9- 15- 29(25(31) 32) 16- 10- 20- 19(24(18) 29) 7- 8- 22- 27(20,5) 13- 11- 21- 26(3,4) 23(30) 12- 14- 28(21,22) 6/h18- 24,30H,1,7- 16H2,2- 6H3,(H,31,32) /t18- ,19- ,20?,21?,22?,23+,24?,27- ,28- ,29- /m0/s1 |
KGUHFCVSCDQVEU-VXZDKHNRSA-N |
O[C@H]1C(C2[C@@](C3[C@](C4[C@@](C5[C@@](CC4)(CC[C@H]5C(C)=C)C(O)=O)(CC3)[H])(CC2)C)(CC1)C)(C)C |
|
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
View more via ChEBI Ontology
Outgoing
|
(1R,3aS,5bS,9R,11aR,13aS)- 9- hydroxy- 5b,8,8,11a- tetramethyl- 1- (prop- 1- en- 2- yl)icosahydro- 3aH- cyclopenta[a]chrysene- 3a- carboxylic acid
(CHEBI:145455)
is a
hydroxy monocarboxylic acid
(CHEBI:35868)
(1R,3aS,5bS,9R,11aR,13aS)- 9- hydroxy- 5b,8,8,11a- tetramethyl- 1- (prop- 1- en- 2- yl)icosahydro- 3aH- cyclopenta[a]chrysene- 3a- carboxylic acid
(CHEBI:145455)
is a
pentacyclic triterpenoid
(CHEBI:25872)
|
|
|