InChI=1S/C20H30O4/c1- 2- 3- 4- 5- 10- 13- 16- 19(24- 23) 17- 14- 11- 8- 6- 7- 9- 12- 15- 18- 20(21) 22/h3- 4,7- 11,13- 14,17,19,23H,2,5- 6,12,15- 16,18H2,1H3,(H,21,22) /p- 1/b4- 3- ,9- 7- ,11- 8- ,13- 10- ,17- 14+ |
HDMYXONNVAOHFR-QGQBRVLBSA-M |
CC\C=C/C\C=C/CC(OO)\C=C\C=C/C\C=C/CCCC([O-])=O |
|
platelet aggregation inhibitor
A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system.
|
|
View more via ChEBI Ontology
(5Z,8Z,10E,14Z,17Z)-12-hydroperoxyicosa-5,8,10,14,17-pentaenoate
|
(5Z,7Z,8Z,10E,14Z,17Z)-12-hydroperoxyeicosapentaenoate
|
UniProt
|
(5Z,8Z,10E,14Z,17Z)-12-hydroperoxyicosapentaenoate
|
SUBMITTER
|
|