2'-deoxyinosine-5'-monophosphate (CHEBI:28806)

ChEBI > Main

CHEBI:28806 - 2'-deoxyinosine-5'-monophosphate

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	2'-deoxyinosine-5'-monophosphate

ChEBI ID	CHEBI:28806

Definition	A deoxyinosine phosphate that is 5'-inosinic acid in which the hydroxy group at position 2' by a hydrogen atom.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:43377, CHEBI:43389, CHEBI:44500, CHEBI:43384, CHEBI:43315, CHEBI:41998, CHEBI:19250, CHEBI:837

Supplier Information	ZINC000013522804

Download	Molfile XML SDF

more structures >>

Molfile

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09130719033D

starting HoverWatcher_5

Time for openFile(

Marvin 09130719033D

31 33 0 0 0 0 999 V2000

1.0744 2.0926 -1.3585 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.3286 1.2035 0.2045 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5343 3.2072 -0.0639 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.4396 0.6731 -1.4910 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5025 1.1034 0.4944 C 0 0 2 0 0 0 0 0 0 0 0 0

4.9129 0.8178 1.1658 C 0 0 0 0 0 0 0 0 0 0 0 0

0.3715 2.2395 -0.5384 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.0862 2.1238 -1.0469 C 0 0 1 0 0 0 0 0 0 0 0 0

2.8549 0.1924 0.3397 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.4425 0.6598 -0.6833 C 0 0 2 0 0 0 0 0 0 0 0 0

3.4258 -0.9214 -0.2838 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.9556 0.4912 -0.5314 C 0 0 0 0 0 0 0 0 0 0 0 0

4.8214 -1.1281 -0.1493 C 0 0 0 0 0 0 0 0 0 0 0 0

1.3048 -0.9564 -0.7217 C 0 0 0 0 0 0 0 0 0 0 0 0

6.4876 -0.3582 0.6888 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7784 1.5150 1.4652 H 0 0 0 0 0 0 0 0 0 0 0 0

5.5029 1.5128 1.7448 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1358 2.2800 -2.1245 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0543 -0.0280 -1.4345 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3464 -1.2639 -1.1133 H 0 0 0 0 0 0 0 0 0 0 0 0

5.5309 -0.2393 0.5814 N 0 0 0 0 0 0 0 0 0 0 0 0

3.6305 1.0221 1.0517 N 0 0 0 0 0 0 0 0 0 0 0 0

2.4296 -1.5817 -0.9186 N 0 0 0 0 0 0 0 0 0 0 0 0

1.5182 0.1440 0.0535 N 0 0 0 0 0 0 0 0 0 0 0 0

-5.3226 0.0470 1.0311 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.2453 -2.4258 0.5310 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.9399 3.0419 -0.3611 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.7784 0.4572 0.5836 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.2454 -0.8388 -0.0964 O 0 0 0 0 0 0 0 0 0 0 0 0

5.3670 -2.0812 -0.6783 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.8459 -0.9450 0.0416 P 0 0 2 0 0 0 0 0 0 0 0 0

1 7 1 0 0 0 0

2 12 1 0 0 0 0

3 7 1 0 0 0 0

4 12 1 0 0 0 0

7 5 1 0 0 0 0

8 7 1 0 0 0 0

10 8 1 0 0 0 0

11 9 4 0 0 0 0

12 10 1 0 0 0 0

13 11 1 0 0 0 0

16 5 1 0 0 0 0

17 6 1 0 0 0 0

18 8 1 0 0 0 0

19 10 1 0 0 0 0

20 14 1 0 0 0 0

21 6 1 0 0 0 0

21 13 1 0 0 0 0

21 15 1 0 0 0 0

22 6 2 0 0 0 0

22 9 1 0 0 0 0

23 11 4 0 0 0 0

23 14 4 0 0 0 0

24 5 1 0 0 0 0

24 9 4 0 0 0 0

24 14 4 0 0 0 0

27 8 1 0 0 0 0

28 5 1 0 0 0 0

28 10 1 0 0 0 0

29 12 1 0 0 0 0

30 13 2 0 0 0 0

31 25 2 0 0 0 0

31 26 1 0 0 0 0

31 29 1 0 0 0 0

M END): 14 ms

reading 31 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

31 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Jmol JavaScript applet jmolApplet1_object__628596179905443__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet1_object__628596179905443__)

viewerOptions:

{ "name":"jmolApplet1_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI%3ACHEBI%3A28806","platform":"J.awtjs2d.Platform","fullName":"jmolApplet1_object__628596179905443__","display":"jmolApplet1_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"628596179905443","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet1_object (signed)

starting HoverWatcher_6

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet1_object__628596179905443__ ready

Molfile expand

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__403009511115085__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__403009511115085__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI%3ACHEBI%3A28806","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__403009511115085__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"403009511115085","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__403009511115085__ ready

starting QueueThread0_7

script 1 started

starting HoverWatcher_8

starting HoverWatcher_9

The Resolver thinks Mol

Marvin 09130718593D

starting HoverWatcher_10

Time for openFile(

Marvin 09130718593D

33 35 0 0 0 0 999 V2000

1.3208 2.0744 -1.3784 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0574 1.2820 0.3016 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8247 3.2255 -0.0983 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2134 0.7146 -1.3783 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.9771 -2.3181 0.8456 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7775 1.1356 0.5090 C 0 0 2 0 0 0 0 0 0 0 0 0

5.1976 0.8047 1.0892 C 0 0 0 0 0 0 0 0 0 0 0 0

0.6385 2.2496 -0.5466 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.8316 2.1424 -1.0200 C 0 0 1 0 0 0 0 0 0 0 0 0

3.1135 0.1890 0.3235 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.1991 0.6922 -0.6148 C 0 0 2 0 0 0 0 0 0 0 0 0

3.6554 -0.9464 -0.2865 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.7105 0.5480 -0.4257 C 0 0 0 0 0 0 0 0 0 0 0 0

5.0509 -1.1693 -0.1782 C 0 0 0 0 0 0 0 0 0 0 0 0

1.5249 -0.9622 -0.6766 C 0 0 0 0 0 0 0 0 0 0 0 0

6.7455 -0.4035 0.6049 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0806 1.5655 1.4637 H 0 0 0 0 0 0 0 0 0 0 0 0

5.8096 1.5045 1.6389 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9033 2.2747 -2.0995 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8370 -0.0178 -1.3584 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5540 -1.2653 -1.0397 H 0 0 0 0 0 0 0 0 0 0 0 0

5.7884 -0.2740 0.5159 N 0 0 0 0 0 0 0 0 0 0 0 0

3.9158 1.0240 0.9989 N 0 0 0 0 0 0 0 0 0 0 0 0

2.6366 -1.6072 -0.8838 N 0 0 0 0 0 0 0 0 0 0 0 0

1.7702 0.1526 0.0681 N 0 0 0 0 0 0 0 0 0 0 0 0

-5.0476 0.1722 1.1986 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.2595 -0.5981 -1.0823 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.6575 3.0876 -0.3369 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.0144 -2.3122 0.7542 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.5095 0.5094 0.6415 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.0081 -0.7676 0.0462 O 0 0 0 0 0 0 0 0 0 0 0 0

5.5718 -2.1416 -0.6970 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.6064 -0.8485 0.2220 P 0 0 2 0 0 0 0 0 0 0 0 0

1 8 1 0 0 0 0

2 13 1 0 0 0 0

3 8 1 0 0 0 0

4 13 1 0 0 0 0

5 29 1 0 0 0 0

8 6 1 0 0 0 0

9 8 1 0 0 0 0

11 9 1 0 0 0 0

12 10 4 0 0 0 0

13 11 1 0 0 0 0

14 12 1 0 0 0 0

17 6 1 0 0 0 0

18 7 1 0 0 0 0

19 9 1 0 0 0 0

20 11 1 0 0 0 0

21 15 1 0 0 0 0

22 7 1 0 0 0 0

22 14 1 0 0 0 0

22 16 1 0 0 0 0

23 7 2 0 0 0 0

23 10 1 0 0 0 0

24 12 4 0 0 0 0

24 15 4 0 0 0 0

25 6 1 0 0 0 0

25 10 4 0 0 0 0

25 15 4 0 0 0 0

28 9 1 0 0 0 0

30 6 1 0 0 0 0

30 11 1 0 0 0 0

31 13 1 0 0 0 0

32 14 2 0 0 0 0

33 26 2 0 0 0 0

33 27 2 0 0 0 0

33 29 1 0 0 0 0

33 31 1 0 0 0 0

M END): 7 ms

reading 33 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

33 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Deoxyinosine monophosphate (dIMP) is a nucleoside monophosphate and a derivative of inosinic acid. It can be formed by the deamination of the purine base in deoxyadenosine monophosphate (dAMP). The enzyme deoxyribonucleoside triphosphate pyrophosphohydrolase, encoded by YJR069C in S. cerevisiae and containing (d)ITPase and (d)XTPase activities, hydrolyses dITP, resulting in the release of pyrophosphate and dIMP.
Read full article at Wikipedia

Formulae

C10H13N4O7P
C10H13N4O7P

Net Charge

Average Mass

332.207

Monoisotopic Mass

332.05219

InChI

InChI=1S/C10H13N4O7P/c15-5-1-7(21-6(5)2-20-22(17,18)19)14-4-13-8-9(14)11-3-12-10(8)16/h3-7,15H,1-2H2,(H,11,12,16)(H2,17,18,19)/t5-,6+,7+/m0/s1

InChIKey

PHNGFPPXDJJADG-RRKCRQDMSA-N

SMILES

C1(=O)NC=NC2=C1N=CN2[C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)C3

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Mycoplasma genitalium (NCBI:txid2097)	See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	2'-deoxyinosine-5'-monophosphate (CHEBI:28806) has functional parent IMP (CHEBI:17202) 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) has role Escherichia coli metabolite (CHEBI:76971) 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) has role Mycoplasma genitalium metabolite (CHEBI:131604) 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) has role human metabolite (CHEBI:77746) 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) has role mouse metabolite (CHEBI:75771) 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) is a deoxyinosine phosphate (CHEBI:23630) 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) is a purine 2'-deoxyribonucleoside 5'-monophosphate (CHEBI:36993) 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) is conjugate acid of 2'-deoxyinosine 5'-phosphate(2−) (CHEBI:61194)

Incoming	2'-deoxyinosine 5'-phosphate(2−) (CHEBI:61194) is conjugate base of 2'-deoxyinosine-5'-monophosphate (CHEBI:28806)

IUPAC Names

2'-deoxy-5'-inosinic acid

[(2R,3S,4R,5R)-3-hydroxy-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-2-yl]methyl dihydrogen phosphate

Synonyms	Sources
2'-deoxy-5'-inosinic acid	PDBeChem
2'-Deoxyinosine 5'-monophosphate	ChemIDplus
2'-Deoxyinosine 5'-monophosphoric acid	HMDB
2'-Deoxyinosine 5'-phosphate	KEGG COMPOUND
2'-Deoxyinosine 5'-phosphate	HMDB
9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol	IUPAC
9-(2-Deoxy-5-O-phosphono-beta-delta-erythro-pentofuranosyl)-9H-purin-6-ol	HMDB
Deoxyinosine monophosphate	ChemIDplus
dIMP	KEGG COMPOUND

Manual Xrefs	Databases
C06196	KEGG COMPOUND
Deoxyinosine_monophosphate	Wikipedia
DI	PDBeChem
DIMP	MetaCyc
HMDB0006555	HMDB
View more database links

Registry Numbers	Types	Sources
3393-18-8	CAS Registry Number	ChemIDplus
583139	Reaxys Registry Number	Reaxys

Citations

Awwad K, Desai A, Smith C, Sommerhalter M (2013)
Structural and functional characterization of a noncanonical nucleoside triphosphate pyrophosphatase from Thermotoga maritima.
Acta crystallographica. Section D, Biological crystallography 69, 184-193 [PubMed:23385455]
[show Abstract]

Karr JR, Sanghvi JC, Macklin DN, Gutschow MV, Jacobs JM, Bolival B, Assad-Garcia N, Glass JI, Covert MW (2012)
A whole-cell computational model predicts phenotype from genotype.
Cell 150, 389-401 [PubMed:22817898]
[show Abstract]

Tsuchimoto D, Iyama T, Nonaka M, Abolhassani N, Ohta E, Sakumi K, Nakabeppu Y (2010)
A comprehensive screening system for damaged nucleotide-binding proteins.
Mutation research 703, 37-42 [PubMed:20542141]
[show Abstract]

Saparbaev M, Mani JC, Laval J (2000)
Interactions of the human, rat, Saccharomyces cerevisiae and Escherichia coli 3-methyladenine-DNA glycosylases with DNA containing dIMP residues.
Nucleic acids research 28, 1332-1339 [PubMed:10684927]
[show Abstract]

Karran P, Lindahl T (1978)
Enzymatic excision of free hypoxanthine from polydeoxynucleotides and DNA containing deoxyinosine monophosphate residues.
The Journal of biological chemistry 253, 5877-5879 [PubMed:98523]
[show Abstract]

Last Modified

14 June 2016

CHEBI:28806 - 2'-deoxyinosine-5'-monophosphate

ChEBI is part of the ELIXIR infrastructure